Compound Q&A

What is L-Arginine L-Aspartate (CAS: 7675-83-4)?

Answer

L-Arginine L-Aspartate
L-Arginine L-Aspartate is a dipeptide composed of the amino acids L-arginine and L-aspartic acid, linked by a peptide bond. Its chemical formula is C8H14N4O4. This compound is known for its role in neurotransmission, muscle function, and as a precursor for nitric oxide synthesis. It is commonly used in pharmaceuticals, dietary supplements, and food additives due to its bioavailability and physiological benefits.

About

CAS No 7675-83-4
English Name L-Arginine L-Aspartate
Molecular Formula C10H21N5O6
Molecular Weight 307.3070000000001 g/mol
SMILES C(C[C@@H](C(=O)O)N)CNC(=N)N.C([C@@H](C(=O)O)N)C(=O)O
InChIKey SUUWYOYAXFUOLX-ZBRNBAAYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of L-Arginine L-Aspartate (CAS: 7675-83-4)?

L-Arginine L-Aspartate is primarily used in pharmaceuticals as a vasodilator and for improving cardi...

Compound Q&A

Is L-Arginine L-Aspartate (CAS: 7675-83-4) safe?

L-Arginine L-Aspartate is generally recognized as safe (GRAS) when used in food and pharmaceutical a...

Compound Q&A

How should L-Arginine L-Aspartate (CAS: 7675-83-4) be stored?

L-Arginine L-Aspartate should be stored in a cool, dry place away from moisture and light. It is bes...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...