Compound Q&A

What are the main uses of (1R,2S,6R,7S)-4-Azatricyclo[5.2.1.0~2,6~]decane-3,5-dione (CAS: 14805-29-9)?

Answer

(1R,2S,6R,7S)-4-Azatricyclo[5.2.1.0~2,6~]decane-3,5-dione
(1R,2S,6R,7S)-4-Azatricyclo[5.2.1.0~2,6~]decane-3,5-dione (CAS: 14805-29-9) is primarily used in the synthesis of bioactive compounds and pharmaceuticals. It serves as a key intermediate in the development of drugs targeting neurological and metabolic disorders. Its unique structure also makes it applicable in organic chemistry research and specialty chemical manufacturing.

About

CAS No 14805-29-9
English Name (1R,2S,6R,7S)-4-Azatricyclo[5.2.1.0~2,6~]decane-3,5-dione
Molecular Formula C9H11NO2
Molecular Weight 165.19 g/mol
SMILES O=C1NC(=O)[C@@H]2[C@H]3CC[C@H](C3)[C@@H]21
InChIKey RIVOBMOBWMOLDJ-RNGGSSJXSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (1R,2S,6R,7S)-4-Azatricyclo[5.2.1.0~2,6~]decane-3,5-dione (CAS: 14805-29-9)?

(1R,2S,6R,7S)-4-Azatricyclo[5.2.1.0~2,6~]decane-3,5-dione (CAS: 14805-29-9) is a complex organic com...

Compound Q&A

Is (1R,2S,6R,7S)-4-Azatricyclo[5.2.1.0~2,6~]decane-3,5-dione (CAS: 14805-29-9) safe?

(1R,2S,6R,7S)-4-Azatricyclo[5.2.1.0~2,6~]decane-3,5-dione (CAS: 14805-29-9) is generally considered ...

Compound Q&A

How should (1R,2S,6R,7S)-4-Azatricyclo[5.2.1.0~2,6~]decane-3,5-dione (CAS: 14805-29-9) be stored?

(1R,2S,6R,7S)-4-Azatricyclo[5.2.1.0~2,6~]decane-3,5-dione (CAS: 14805-29-9) should be stored in a co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...