Compound Q&A

How should Thiamethoxam (CAS: 153719-23-4) be stored?

Answer

Thiamethoxam
Thiamethoxam should be stored in a cool, dry, and well-ventilated place, away from direct sunlight. It is stable under normal storage conditions but may degrade if exposed to high temperatures or humidity. Always keep it in a sealed container to prevent contamination and maintain its efficacy. Proper storage is crucial to ensure safety and effectiveness when handling this compound.

About

English Name Thiamethoxam
Molecular Formula C8H10ClN5O3S
Molecular Weight 291.72 g/mol
SMILES CN1COCN(C1=N[N+](=O)[O-])CC2=CN=C(S2)Cl
InChIKey NWWZPOKUUAIXIW-DHZHZOJOSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Thiamethoxam (CAS: 153719-23-4)?

Thiamethoxam is a synthetic neonicotinoid insecticide with the chemical formula C10H13N5O2S. It is k...

Compound Q&A

What are the main uses of Thiamethoxam (CAS: 153719-23-4)?

Thiamethoxam is primarily used as a systemic insecticide in crops to control pests such as aphids, t...

Compound Q&A

Is Thiamethoxam (CAS: 153719-23-4) safe?

Thiamethoxam is considered relatively safe for mammals and humans when used according to guidelines,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...