Compound Q&A

What is (1R,2R)-1,2-Diphenyl-1,2-ethanediamine (CAS: 35132-20-8)?

Answer

(1R,2R)-1,2-Diphenyl-1,2-ethanediamine
(1R,2R)-1,2-Diphenyl-1,2-ethanediamine, with CAS number 35132-20-8, is a chiral diamine compound characterized by two phenyl groups attached to adjacent carbon atoms of an ethane backbone. It is commonly used as an intermediate in the synthesis of various pharmaceuticals and organic compounds due to its structural versatility and reactivity. The compound is typically solid at room temperature and has a high molecular weight.

About

CAS No 35132-20-8
English Name (1R,2R)-1,2-Diphenyl-1,2-ethanediamine
Molecular Formula C14H16N2
Molecular Weight 212.3 g/mol
SMILES C1=CC=C(C=C1)C(C(C2=CC=CC=C2)N)N
InChIKey PONXTPCRRASWKW-ZIAGYGMSSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (1R,2R)-1,2-Diphenyl-1,2-ethanediamine (CAS: 35132-20-8)?

(1R,2R)-1,2-Diphenyl-1,2-ethanediamine (CAS: 35132-20-8) is primarily used in the pharmaceutical ind...

Compound Q&A

Is (1R,2R)-1,2-Diphenyl-1,2-ethanediamine (CAS: 35132-20-8) safe?

(1R,2R)-1,2-Diphenyl-1,2-ethanediamine (CAS: 35132-20-8) is generally considered safe when handled p...

Compound Q&A

How should (1R,2R)-1,2-Diphenyl-1,2-ethanediamine (CAS: 35132-20-8) be stored?

(1R,2R)-1,2-Diphenyl-1,2-ethanediamine (CAS: 35132-20-8) should be stored in a cool, dry, and dark p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...