Compound Q&A

What are the main uses of (3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyldecahydronaphtho[2,1-b]furan-2(1H)-one (CAS: 564-20-5)?

Answer

(3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyldecahydronaphtho[2,1-b]furan-2(1H)-one
The compound (CAS: 564-20-5) is primarily utilized as a pharmaceutical intermediate and in research for drug development. It may also find applications in industrial chemistry, such as polymer synthesis or specialty chemical manufacturing. Its unique structure makes it valuable for creating derivatives with specific biological activities, though specific applications depend on further chemical modification and testing.

About

CAS No 564-20-5
English Name (3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyldecahydronaphtho[2,1-b]furan-2(1H)-one
Molecular Formula C16H26O2
Molecular Weight 250.38 g/mol
SMILES O=C1C[C@@]2([H])[C@](CC[C@@]3([H])C(C)(C)CCC[C@@]32C)(C)O1
InChIKey IMKJGXCIJJXALX-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyldecahydronaphtho[2,1-b]furan-2(1H)-one (CAS: 564-20-5)?

This compound, with the CAS number 564-20-5, is a complex organic molecule classified as a substitut...

Compound Q&A

Is (3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyldecahydronaphtho[2,1-b]furan-2(1H)-one (CAS: 564-20-5) safe?

Safety of (CAS: 564-20-5) depends on proper handling and exposure limits. While it is generally cons...

Compound Q&A

How should (3aR,5aS,9aS,9bR)-3a,6,6,9a-tetramethyldecahydronaphtho[2,1-b]furan-2(1H)-one (CAS: 564-20-5) be stored?

This compound (CAS: 564-20-5) should be stored in a cool, dry place away from light and moisture. Us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...