Compound Q&A

Is (3beta)-3,23-Dihydroxyolean-12-en-28-oic acid (CAS: 465-99-6) safe?

Answer

(3beta)-3,23-Dihydroxyolean-12-en-28-oic acid
The safety of (3beta)-3,23-Dihydroxyolean-12-en-28-oic acid (CAS: 465-99-6) depends on its application and exposure level. While it is generally considered safe in controlled research settings, it may cause mild skin irritation or respiratory discomfort if mishandled. Proper protective equipment, such as gloves and safety goggles, should be used during handling, and adherence to standard chemical safety protocols is recommended to minimize risks.

About

CAS No 465-99-6
English Name (3beta)-3,23-Dihydroxyolean-12-en-28-oic acid
Molecular Formula C30H48O4
Molecular Weight 472.71 g/mol
SMILES CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)[C@@](C)(CO)[C@@H]5CC[C@@]34C)[C@@H]2C1)C(O)=O
InChIKey PGOYMURMZNDHNS-MYPRUECHSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (3beta)-3,23-Dihydroxyolean-12-en-28-oic acid (CAS: 465-99-6)?

(3beta)-3,23-Dihydroxyolean-12-en-28-oic acid (CAS: 465-99-6) is a triterpenoid compound derived fro...

Compound Q&A

What are the main uses of (3beta)-3,23-Dihydroxyolean-12-en-28-oic acid (CAS: 465-99-6)?

(3beta)-3,23-Dihydroxyolean-12-en-28-oic acid (CAS: 465-99-6) is primarily used in pharmaceutical re...

Compound Q&A

How should (3beta)-3,23-Dihydroxyolean-12-en-28-oic acid (CAS: 465-99-6) be stored?

(3beta)-3,23-Dihydroxyolean-12-en-28-oic acid (CAS: 465-99-6) should be stored in a cool, dry, and d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...