Compound Q&A

How should 1H-Indole-2-carboxylic acid (CAS: 1477-50-5) be stored?

Answer

1H-Indole-2-carboxylic acid
1H-Indole-2-carboxylic acid should be stored in a cool, dry, and well-ventilated place, away from light. It is typically kept in sealed containers at a temperature below 25°C. Avoid exposure to moisture and incompatible substances to maintain its stability and prevent degradation.

About

CAS No 1477-50-5
English Name 1H-Indole-2-carboxylic acid
Molecular Formula C9H7NO2
Molecular Weight 161.16 g/mol
SMILES C1=CC=C2C(=C1)C=C(N2)C(=O)O
InChIKey HCUARRIEZVDMPT-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 1H-Indole-2-carboxylic acid (CAS: 1477-50-5)?

1H-Indole-2-carboxylic acid is an organic compound with the chemical formula C8H7NO2. It is a hetero...

Compound Q&A

What are the main uses of 1H-Indole-2-carboxylic acid (CAS: 1477-50-5)?

1H-Indole-2-carboxylic acid is primarily used in pharmaceutical research for the development of drug...

Compound Q&A

Is 1H-Indole-2-carboxylic acid (CAS: 1477-50-5) safe?

1H-Indole-2-carboxylic acid is generally considered safe when handled properly. However, it should b...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...