Compound Q&A

What is Homoveratric acid (CAS: 93-40-3)?

Answer

Homoveratric acid
Homoveratric acid, with the CAS number 93-40-3, is a naturally occurring organic compound belonging to the class of phenolic acids. Its chemical formula is C10H12O5, and it is known for its aromatic structure and hydroxyl groups. Homoveratric acid is commonly used as a precursor in the synthesis of various pharmaceuticals and bioactive compounds due to its versatile chemical properties.

About

CAS No 93-40-3
English Name Homoveratric acid
Molecular Formula C10H12O4
Molecular Weight 196.202 g/mol
SMILES COC1=C(C=C(C=C1)CC(=O)O)OC
InChIKey WUAXWQRULBZETB-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Homoveratric acid (CAS: 93-40-3)?

Homoveratric acid (CAS: 93-40-3) is primarily used in the pharmaceutical industry as a building bloc...

Compound Q&A

Is Homoveratric acid (CAS: 93-40-3) safe?

Homoveratric acid (CAS: 93-40-3) is generally considered safe when handled properly. However, it sho...

Compound Q&A

How should Homoveratric acid (CAS: 93-40-3) be stored?

Homoveratric acid (CAS: 93-40-3) should be stored in a cool, dry, and well-ventilated place, away fr...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...