Compound Q&A

What is Benzyl(triphenyl)phosphonium chloride (CAS: 1100-88-5)?

Answer

Benzyl(triphenyl)phosphonium chloride
Benzyl(triphenyl)phosphonium chloride is an organophosphorus compound with the chemical formula C26H25ClP. It is a yellow solid that is soluble in organic solvents and exhibits moderate solubility in water. This compound is known for its phosphorus-containing structure, which makes it useful in various chemical reactions, particularly in organic synthesis and catalytic processes.

About

CAS No 1100-88-5
English Name Benzyl(triphenyl)phosphonium chloride
Molecular Formula C25H22ClP
Molecular Weight 388.9 g/mol
SMILES C1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]
InChIKey USFRYJRPHFMVBZ-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Benzyl(triphenyl)phosphonium chloride (CAS: 1100-88-5)?

Benzyl(triphenyl)phosphonium chloride is primarily used as a coupling agent in pharmaceutical resear...

Compound Q&A

Is Benzyl(triphenyl)phosphonium chloride (CAS: 1100-88-5) safe?

Benzyl(triphenyl)phosphonium chloride is considered toxic and should be handled with care. Protectiv...

Compound Q&A

How should Benzyl(triphenyl)phosphonium chloride (CAS: 1100-88-5) be stored?

Benzyl(triphenyl)phosphonium chloride should be stored in a cool, dry, and dark place, away from moi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...