Compound Q&A

What are the main uses of Diphenylphosphine (CAS: 829-85-6)?

Answer

Diphenylphosphine
Diphenylphosphine is widely used in pharmaceutical research for the development of drugs and as a ligand in catalytic processes. It also finds applications in industrial chemistry for producing flame retardants and in organic synthesis for creating complex molecules. Additionally, it is utilized in research for studying phosphorus chemistry and its role in various chemical transformations.

About

CAS No 829-85-6
English Name Diphenylphosphine
Molecular Formula C12H11P
Molecular Weight 186.19 g/mol
SMILES C1=CC=C(C=C1)PC2=CC=CC=C2
InChIKey GPAYUJZHTULNBE-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Diphenylphosphine (CAS: 829-85-6)?

Diphenylphosphine is an organic phosphorus compound with the chemical formula C13H14P. It is a color...

Compound Q&A

Is Diphenylphosphine (CAS: 829-85-6) safe?

Diphenylphosphine is considered toxic and requires careful handling. It should be used in well-venti...

Compound Q&A

How should Diphenylphosphine (CAS: 829-85-6) be stored?

Diphenylphosphine should be stored in a cool, dry, and well-ventilated area, away from light and moi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...