Compound Q&A

What is Potassium Perfluoro-1-butanesulfonate (CAS: 29420-49-3)?

Answer

Potassium Perfluoro-1-butanesulfonate
Potassium Perfluoro-1-butanesulfonate is an inorganic salt with the chemical formula C4F9KO2S. It is a white crystalline solid that is highly hydrophobic and exhibits strong surfactant properties. This compound is known for its unique chemical stability and resistance to thermal and chemical degradation, making it suitable for specialized applications.

About

CAS No 29420-49-3
English Name Potassium Perfluoro-1-butanesulfonate
Molecular Formula C4F9KO3S
Molecular Weight 338.19 g/mol
SMILES C(C(C(F)(F)S(=O)(=O)[O-])(F)F)(C(F)(F)F)(F)F.[K+]
InChIKey LVTHXRLARFLXNR-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Potassium Perfluoro-1-butanesulfonate (CAS: 29420-49-3)?

Potassium Perfluoro-1-butanesulfonate is primarily used in pharmaceuticals as a surfactant and wetti...

Compound Q&A

Is Potassium Perfluoro-1-butanesulfonate (CAS: 29420-49-3) safe?

Potassium Perfluoro-1-butanesulfonate is generally considered safe when handled properly, but it sho...

Compound Q&A

How should Potassium Perfluoro-1-butanesulfonate (CAS: 29420-49-3) be stored?

Potassium Perfluoro-1-butanesulfonate should be stored in a cool, dry, and well-ventilated area, awa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...