Compound Q&A

How should (2S,2'S)-5,5'-[Disulfanediylbis({(2R)-3-[(carboxymethyl)amino]-3-oxo-1,2-propanediyl}imino)]bis(2-amino-5-oxopentanoic acid) (CAS: 27025-41-8) be stored?

Answer

(2S,2'S)-5,5'-[Disulfanediylbis({(2R)-3-[(carboxymethyl)amino]-3-oxo-1,2-propanediyl}imino)]bis(2-amino-5-oxopentanoic acid) (non-preferred name)
This compound should be stored in a cool, dry place (ideally below 25°C), away from light, and in a sealed container to maintain stability. It is sensitive to moisture and air, so desiccated storage conditions are recommended. Keep it in a well-ventilated area and ensure the container is labeled clearly to prevent contamination or exposure.

About

CAS No 27025-41-8
English Name (2S,2'S)-5,5'-[Disulfanediylbis({(2R)-3-[(carboxymethyl)amino]-3-oxo-1,2-propanediyl}imino)]bis(2-amino-5-oxopentanoic acid) (non-preferred name)
Molecular Formula C20H32N6O12S2
Molecular Weight 612.64 g/mol
SMILES N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O)C(=O)NCC(=O)O)C(=O)O
InChIKey YPZRWBKMTBYPTK-BJDJZHNGSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2S,2'S)-5,5'-[Disulfanediylbis({(2R)-3-[(carboxymethyl)amino]-3-oxo-1,2-propanediyl}imino)]bis(2-amino-5-oxopentanoic acid) (CAS: 27025-41-8)?

This compound, with the CAS number 27025-41-8, is a complex dipeptide featuring two 2-amino-5-oxopen...

Compound Q&A

What are the main uses of (2S,2'S)-5,5'-[Disulfanediylbis({(2R)-3-[(carboxymethyl)amino]-3-oxo-1,2-propanediyl}imino)]bis(2-amino-5-oxopentanoic acid) (CAS: 27025-41-8)?

This compound is primarily used in pharmaceutical research as a potential drug molecule due to its s...

Compound Q&A

Is (2S,2'S)-5,5'-[Disulfanediylbis({(2R)-3-[(carboxymethyl)amino]-3-oxo-1,2-propanediyl}imino)]bis(2-amino-5-oxopentanoic acid) (CAS: 27025-41-8) safe?

Safety data for this compound is limited, but it is generally considered low-toxicity when handled p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...