Compound Q&A

What are the main uses of 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride hydrochloride (1:1:1) (CAS: 137-88-2)?

Answer

1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride hydrochloride (1:1:1)
This compound is primarily utilized in pharmaceutical research for synthesizing bioactive molecules and as a key intermediate in drug development. It also finds applications in organic chemistry for catalytic reactions and in the production of specialty chemicals. Its unique structure makes it valuable in creating compounds with specific functional group combinations, though exact uses depend on further chemical modification and application context.

About

CAS No 137-88-2
English Name 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride hydrochloride (1:1:1)
Molecular Formula C14H20Cl2N4
Molecular Weight 315.2 g/mol
SMILES CCCC1=NC=C(C(=N1)N)C[N+]2=CC=CC=C2C.Cl.[Cl-]
InChIKey PJBQYZZKGNOKNJ-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride hydrochloride (1:1:1) (CAS: 137-88-2)?

1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride hydrochloride (1:1:1), with C...

Compound Q&A

Is 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride hydrochloride (1:1:1) (CAS: 137-88-2) safe?

Safety of this compound requires adherence to standard chemical handling protocols. It may pose risk...

Compound Q&A

How should 1-[(4-Amino-2-propyl-5-pyrimidinyl)methyl]-2-methylpyridinium chloride hydrochloride (1:1:1) (CAS: 137-88-2) be stored?

Store this compound in a cool, dry place (ideally 25°C or below) in a sealed, light-resistant contai...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...