Compound Q&A

What is 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl benzoate (CAS: 13182-89-3)?

Answer

2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl benzoate
2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl benzoate is an organic compound with the CAS number 13182-89-3. It is a benzoate ester derivative containing an imidazole ring with nitro and methyl substituents. This compound is known for its aromatic structure and potential applications in chemical research and pharmaceutical development. It exhibits moderate solubility in organic solvents and is typically used in controlled environments due to its chemical reactivity.

About

CAS No 13182-89-3
English Name 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl benzoate
Molecular Formula C13H13N3O4
Molecular Weight 275.26 g/mol
SMILES CC1=NC=C(N1CCOC(=O)C2=CC=CC=C2)[N+](=O)[O-]
InChIKey CUUCCLJJOWSASK-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl benzoate (CAS: 13182-89-3)?

The primary uses of 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl benzoate (CAS: 13182-89-3) include ph...

Compound Q&A

Is 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl benzoate (CAS: 13182-89-3) safe?

2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl benzoate (CAS: 13182-89-3) is generally considered safe w...

Compound Q&A

How should 2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl benzoate (CAS: 13182-89-3) be stored?

2-(2-Methyl-5-nitro-1H-imidazol-1-yl)ethyl benzoate (CAS: 13182-89-3) should be stored in a cool, dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...