Compound Q&A

What is 1,3-Diphenyl-1,3-propanedione (CAS: 120-46-7)?

Answer

1,3-Diphenyl-1,3-propanedione
1,3-Diphenyl-1,3-propanedione, with the CAS number 120-46-7, is an organic compound characterized by two phenyl groups attached to a diketone structure. It is a yellow solid with a molecular formula of C15H12O2 and is known for its conjugated system, which contributes to its stability and reactivity in various chemical processes.

About

CAS No 120-46-7
English Name 1,3-Diphenyl-1,3-propanedione
Molecular Formula C15H12O2
Molecular Weight 224.26 g/mol
SMILES O=C(CC(=O)c1ccccc1)c2ccccc2
InChIKey NZZIMKJIVMHWJC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 1,3-Diphenyl-1,3-propanedione (CAS: 120-46-7)?

1,3-Diphenyl-1,3-propanedione is primarily used as a synthetic intermediate in the pharmaceutical in...

Compound Q&A

Is 1,3-Diphenyl-1,3-propanedione (CAS: 120-46-7) safe?

1,3-Diphenyl-1,3-propanedione is considered hazardous due to its potential to cause skin and eye irr...

Compound Q&A

How should 1,3-Diphenyl-1,3-propanedione (CAS: 120-46-7) be stored?

1,3-Diphenyl-1,3-propanedione should be stored in a cool, dry, and dark place to maintain its stabil...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...