Compound Q&A

How should N-Methyl-N,N-dioctyl-1-octanaminium chloride (CAS: 5137-55-3) be stored?

Answer

N-Methyl-N,N-dioctyl-1-octanaminium chloride
N-Methyl-N,N-dioctyl-1-octanaminium chloride (CAS: 5137-55-3) should be stored in a cool, dry place away from direct sunlight. It is stable under normal conditions but should be kept in a sealed container to prevent moisture absorption and contamination. Store in a well-ventilated area to ensure safety.

About

CAS No 5137-55-3
English Name N-Methyl-N,N-dioctyl-1-octanaminium chloride
Molecular Formula C25H54ClN
Molecular Weight 404.16 g/mol
SMILES [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC
InChIKey XKBGEWXEAPTVCK-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is N-Methyl-N,N-dioctyl-1-octanaminium chloride (CAS: 5137-55-3)?

N-Methyl-N,N-dioctyl-1-octanaminium chloride (CAS: 5137-55-3) is a quaternary ammonium compound with...

Compound Q&A

What are the main uses of N-Methyl-N,N-dioctyl-1-octanaminium chloride (CAS: 5137-55-3)?

N-Methyl-N,N-dioctyl-1-octanaminium chloride (CAS: 5137-55-3) is commonly used as a surfactant in de...

Compound Q&A

Is N-Methyl-N,N-dioctyl-1-octanaminium chloride (CAS: 5137-55-3) safe?

N-Methyl-N,N-dioctyl-1-octanaminium chloride (CAS: 5137-55-3) is generally considered safe when hand...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...