Compound Q&A

How should Atazanavir related compound A (CAS: 162537-11-3) be stored?

Answer

Atazanavir related compound A
Atazanavir related compound A (CAS: 162537-11-3) should be stored in a cool, dry place, away from light and moisture. It is typically kept in airtight containers at temperatures below 25°C (77°F) to maintain stability. Avoid exposure to air and ensure proper ventilation to prevent degradation or contamination.

About

English Name Atazanavir related compound A
Molecular Formula C8H15NO4
Molecular Weight 189.21 g/mol
SMILES CC(C)(C)C(C(=O)O)NC(=O)OC
InChIKey NWPRXAIYBULIEI-RXMQYKEDSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Atazanavir related compound A (CAS: 162537-11-3)?

Atazanavir related compound A (CAS: 162537-11-3) is a chemical compound structurally similar to ataz...

Compound Q&A

What are the main uses of Atazanavir related compound A (CAS: 162537-11-3)?

Atazanavir related compound A (CAS: 162537-11-3) is primarily used in pharmaceutical research to dev...

Compound Q&A

Is Atazanavir related compound A (CAS: 162537-11-3) safe?

Atazanavir related compound A (CAS: 162537-11-3) is generally considered safe when handled properly ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...