Compound Q&A

What is 2-Aminobenzenesulfonic acid (CAS: 88-21-1)?

Answer

2-Aminobenzenesulfonic acid
2-Aminobenzenesulfonic acid, with the CAS number 88-21-1, is an organic compound containing a sulfonic acid group and an amino group attached to a benzene ring. Its chemical formula is C6H7NO3S. It is a white crystalline solid that is soluble in water and commonly used in various chemical applications due to its reactivity and functional groups.

About

CAS No 88-21-1
English Name 2-Aminobenzenesulfonic acid
Molecular Formula C6H7NO3S
Molecular Weight 173.19 g/mol
SMILES C1=CC=C(C(=C1)N)S(=O)(=O)O
InChIKey ZMCHBSMFKQYNKA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2-Aminobenzenesulfonic acid (CAS: 88-21-1)?

2-Aminobenzenesulfonic acid is widely used in the pharmaceutical industry for the synthesis of drugs...

Compound Q&A

Is 2-Aminobenzenesulfonic acid (CAS: 88-21-1) safe?

2-Aminobenzenesulfonic acid is generally considered safe when handled properly, but it may cause ski...

Compound Q&A

How should 2-Aminobenzenesulfonic acid (CAS: 88-21-1) be stored?

2-Aminobenzenesulfonic acid should be stored in a cool, dry place away from moisture and direct ligh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...