Compound Q&A

What is 3-Chloro-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 3327-22-8)?

Answer

3-Chloro-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride
3-Chloro-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 3327-22-8) is a quaternary ammonium chloride compound with the chemical formula C6H14Cl2NO+. It features a hydroxyl group on the second carbon and chloro groups on the third carbon of a propanamine backbone, with three methyl groups attached to the nitrogen. This compound is known for its cationic charge and is commonly used in chemical synthesis and specialized industrial applications.

About

CAS No 3327-22-8
English Name 3-Chloro-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride
Molecular Formula C6H15Cl2NO
Molecular Weight 188.09 g/mol
SMILES C[N+](C)(C)CC(CCl)O.[Cl-]
InChIKey CSPHGSFZFWKVDL-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 3-Chloro-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 3327-22-8)?

3-Chloro-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 3327-22-8) is primarily used in ph...

Compound Q&A

Is 3-Chloro-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 3327-22-8) safe?

3-Chloro-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 3327-22-8) requires careful handli...

Compound Q&A

How should 3-Chloro-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 3327-22-8) be stored?

3-Chloro-2-hydroxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 3327-22-8) should be stored in a c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...