Compound Q&A

What are the main uses of 4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzenecarboximidic acid (CAS: 364-62-5)?

Answer

4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzenecarboximidic acid
This compound is primarily utilized in pharmaceutical research as a building block for drug development, particularly in the synthesis of bioactive molecules. It also finds applications in agrochemicals and industrial chemistry due to its reactivity. Its unique structure makes it valuable for creating derivatives with specific therapeutic or functional properties, including potential use in antiviral or antimicrobial agents.

About

CAS No 364-62-5
English Name 4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzenecarboximidic acid
Molecular Formula C14H22ClN3O2
Molecular Weight 299.8 g/mol
SMILES CCN(CC)CCNC(=O)C1=CC(=C(C=C1OC)N)Cl
InChIKey TTWJBBZEZQICBI-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzenecarboximidic acid (CAS: 364-62-5)?

4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzenecarboximidic acid (CAS: 364-62-5) is a sy...

Compound Q&A

Is 4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzenecarboximidic acid (CAS: 364-62-5) safe?

Safety of 4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzenecarboximidic acid (CAS: 364-62-...

Compound Q&A

How should 4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzenecarboximidic acid (CAS: 364-62-5) be stored?

Store 4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzenecarboximidic acid (CAS: 364-62-5) i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...