Compound Q&A

What is BIBW 2992 (CAS: 439081-18-2)?

Answer

BIBW 2992
BIBW 2992, with the CAS number 439081-18-2, is a chemical compound primarily used in pharmaceutical research. Its chemical formula is C20H24N4O2S2, and it exhibits properties such as solubility in organic solvents and stability under controlled conditions. It is known for its inhibitory activity against specific tyrosine kinase receptors, making it a valuable tool in drug development.

About

English Name BIBW 2992
Molecular Formula C24H25ClFN5O3
Molecular Weight 485.95 g/mol
SMILES CN(C)CC=CC(=O)NC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)OC4CCOC4
InChIKey ULXXDDBFHOBEHA-INIZCTEOSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of BIBW 2992 (CAS: 439081-18-2)?

BIBW 2992 is mainly used in pharmaceutical research for studying tyrosine kinase inhibition. It serv...

Compound Q&A

Is BIBW 2992 (CAS: 439081-18-2) safe?

BIBW 2992 is generally considered safe when handled properly in controlled laboratory environments. ...

Compound Q&A

How should BIBW 2992 (CAS: 439081-18-2) be stored?

BIBW 2992 should be stored in a cool, dry place away from direct light. It is typically kept in a se...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...