Compound Q&A

What are the main uses of (2R)-2-(4-Hydroxyphenoxy)propanoic acid (CAS: 94050-90-5)?

Answer

(2R)-2-(4-Hydroxyphenoxy)propanoic acid
(2R)-2-(4-Hydroxyphenoxy)propanoic acid (CAS: 94050-90-5) is primarily used in pharmaceutical research as a precursor for drug development, particularly in anti-inflammatory and antioxidant compounds. It also finds applications in industrial chemistry for polymer synthesis and as a stabilizing agent. Additionally, it is utilized in cosmetic formulations and research for its unique chemical properties, including its ability to interact with biomolecules. Its versatility makes it relevant in various scientific fields.

About

CAS No 94050-90-5
English Name (2R)-2-(4-Hydroxyphenoxy)propanoic acid
Molecular Formula C9H10O4
Molecular Weight 182.17 g/mol
SMILES C[C@@H](Oc1ccc(O)cc1)C(=O)O
InChIKey AQIHDXGKQHFBNW-ZCFIWIBFSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2R)-2-(4-Hydroxyphenoxy)propanoic acid (CAS: 94050-90-5)?

(2R)-2-(4-Hydroxyphenoxy)propanoic acid (CAS: 94050-90-5) is a chiral organic compound with the chem...

Compound Q&A

Is (2R)-2-(4-Hydroxyphenoxy)propanoic acid (CAS: 94050-90-5) safe?

The safety of (2R)-2-(4-Hydroxyphenoxy)propanoic acid (CAS: 94050-90-5) depends on exposure conditio...

Compound Q&A

How should (2R)-2-(4-Hydroxyphenoxy)propanoic acid (CAS: 94050-90-5) be stored?

(2R)-2-(4-Hydroxyphenoxy)propanoic acid (CAS: 94050-90-5) should be stored in a cool, dry place, awa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...