Compound Q&A

What are the main uses of Methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate (CAS: 57837-19-1)?

Answer

Methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate
This compound is primarily used in pharmaceutical research for the development of drug molecules and as an intermediate in the synthesis of various organic compounds. It also finds applications in industrial chemistry for polymer synthesis and in the production of fine chemicals. Additionally, it is utilized in research settings for studying reaction mechanisms and functional group transformations.

About

CAS No 57837-19-1
English Name Methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate
Molecular Formula C15H21NO4
Molecular Weight 279.34 g/mol
SMILES C[CH](N(C1=C(C)C=CC=C1C)C(COC)=O)C(OC)=O
InChIKey ZQEIXNIJLIKNTD-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate (CAS: 57837-19-1)?

Methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate is an organic compound with the CAS number ...

Compound Q&A

Is Methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate (CAS: 57837-19-1) safe?

Methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate is generally considered safe when handled p...

Compound Q&A

How should Methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate (CAS: 57837-19-1) be stored?

Methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate should be stored in a cool, dry, and well-v...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...