Compound Q&A

What is L-Ascorbic acid 2-glucoside (CAS: 129499-78-1)?

Answer

L-Ascorbic acid 2-glucoside
L-Ascorbic acid 2-glucoside is a naturally occurring derivative of vitamin C, commonly known as ascorbyl palmitate. It has the chemical formula C16H21NO13 and is a white crystalline powder that is soluble in water and alcohol. This compound is often used as a fat-soluble antioxidant in various industries due to its stability and effectiveness in preventing oxidation.

About

English Name L-Ascorbic acid 2-glucoside
Molecular Formula C12H18O11
Molecular Weight 338.27 g/mol
SMILES O=C1O[C@H]([C@@H](O)CO)C(O)=C1O[C@@H]2[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O2
InChIKey MLSJBGYKDYSOAE-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of L-Ascorbic acid 2-glucoside (CAS: 129499-78-1)?

L-Ascorbic acid 2-glucoside is primarily used as an antioxidant in the food, cosmetic, and pharmaceu...

Compound Q&A

Is L-Ascorbic acid 2-glucoside (CAS: 129499-78-1) safe?

L-Ascorbic acid 2-glucoside is generally considered safe when used as directed. It has low toxicity ...

Compound Q&A

How should L-Ascorbic acid 2-glucoside (CAS: 129499-78-1) be stored?

L-Ascorbic acid 2-glucoside should be stored in a cool, dry place away from light. It is recommended...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...