Compound Q&A

What is sodium (1-oxidopyridin-1-ium-2-yl)sulfanide (CAS: 3811-73-2)?

Answer

sodium (1-oxidopyridin-1-ium-2-yl)sulfanide
Sodium (1-oxidopyridin-1-ium-2-yl)sulfanide (CAS: 3811-73-2) is a chemical compound with the formula C5H6N2O2SNa. It is a sulfanide derivative containing a pyridinium ring functionalized with an oxygen atom and a sodium ion. The compound is typically a yellow solid, known for its reactivity in organic synthesis and applications in pharmaceutical chemistry. It exhibits solubility in polar solvents and is characterized by its role as an intermediate in the production of various bioactive molecules.

About

CAS No 3811-73-2
English Name sodium (1-oxidopyridin-1-ium-2-yl)sulfanide
Molecular Formula C5H4NNaOS
Molecular Weight 149.1461 g/mol
SMILES [Na+].[O-][n+]1ccccc1[S-]
InChIKey WNGMMIYXPIAYOB-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of sodium (1-oxidopyridin-1-ium-2-yl)sulfanide (CAS: 3811-73-2)?

Sodium (1-oxidopyridin-1-ium-2-yl)sulfanide (CAS: 3811-73-2) is primarily used in pharmaceutical res...

Compound Q&A

Is sodium (1-oxidopyridin-1-ium-2-yl)sulfanide (CAS: 3811-73-2) safe?

Sodium (1-oxidopyridin-1-ium-2-yl)sulfanide (CAS: 3811-73-2) requires careful handling due to its po...

Compound Q&A

How should sodium (1-oxidopyridin-1-ium-2-yl)sulfanide (CAS: 3811-73-2) be stored?

Sodium (1-oxidopyridin-1-ium-2-yl)sulfanide (CAS: 3811-73-2) should be stored in a tightly sealed co...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...