Compound Q&A

What is Carboxymethyl Chitosan (CAS: 83512-85-0)?

Answer

Carboxymethyl Chitosan
Carboxymethyl chitosan (CAS: 83512-85-0) is a derivative of chitosan, a naturally occurring polysaccharide derived from chitin. It features carboxymethyl groups attached to the chitosan backbone, enhancing its solubility in aqueous solutions and providing unique functional properties. This compound is known for its biocompatibility, biodegradability, and ability to form gels, making it valuable in various scientific and industrial applications.

About

CAS No 83512-85-0
English Name Carboxymethyl Chitosan
Molecular Formula C20H37N3O14
Molecular Weight 543.52 g/mol
SMILES CC(=O)NC1C(C(C(OC1OC2C(OC(C(C2O)N)O)CO)CO)OC3C(C(C(C(O3)CO)O)O)N)O
InChIKey HGNQXZLWHDQLRE-XADFZESNSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Carboxymethyl Chitosan (CAS: 83512-85-0)?

Carboxymethyl chitosan (CAS: 83512-85-0) is widely used in pharmaceuticals as a drug delivery system...

Compound Q&A

Is Carboxymethyl Chitosan (CAS: 83512-85-0) safe?

Carboxymethyl chitosan (CAS: 83512-85-0) is generally considered safe due to its biocompatible and b...

Compound Q&A

How should Carboxymethyl Chitosan (CAS: 83512-85-0) be stored?

Carboxymethyl chitosan ( CAS: 83512-85-0 ) should be stored in a cool, dry place away from direct li...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...