Compound Q&A

What is N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-alanine (CAS: 15761-38-3)?

Answer

N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-alanine
N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-alanine is a synthetic amino acid derivative with the chemical formula C10H19NO4. It features a tert-butoxycarbonyl (t-Boc) group attached to the nitrogen of L-alanine, making it a key intermediate in organic synthesis. This compound is commonly used in pharmaceutical research due to its stability and reactivity in peptide chemistry. Its molecular weight is 205.26 g/mol, and it is typically a white solid with moderate solubility in polar solvents.

About

CAS No 15761-38-3
English Name N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-alanine
Molecular Formula C8H15NO4
Molecular Weight 189.21 g/mol
SMILES C[C@H](NC(=O)OC(C)(C)C)C(=O)O
InChIKey QVHJQCGUWFKTSE-YFKPBYRVSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-alanine (CAS: 15761-38-3)?

N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-alanine is primarily used as a building block in the synthe...

Compound Q&A

Is N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-alanine (CAS: 15761-38-3) safe?

N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-alanine is generally considered safe when handled according...

Compound Q&A

How should N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-alanine (CAS: 15761-38-3) be stored?

This compound should be stored in a cool, dry place, away from light, in a sealed, airtight containe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...