Compound Q&A

What are the main uses of ethyl (2Z)-2-chloro-2-(phenylhydrazinylidene)acetate (CAS: 9000-40-2)?

Answer

ethyl (2Z)-2-chloro-2-(phenylhydrazinylidene)acetate
Ethyl (2Z)-2-chloro-2-(phenylhydrazinylidene)acetate (CAS: 9000-40-2) is primarily utilized in pharmaceutical research for synthesizing drugs targeting fungal and viral infections. It also serves as an industrial chemical intermediate and is employed in organic synthesis for developing new compounds. Additionally, its applications extend to research laboratories for studying reaction mechanisms and functional group transformations. The compound’s unique structure makes it valuable in medicinal chemistry and chemical innovation.

About

CAS No 9000-40-2
English Name ethyl (2Z)-2-chloro-2-(phenylhydrazinylidene)acetate
Molecular Formula C10H11ClN2O2
Molecular Weight 226.66 g/mol
SMILES CCOC(=O)C(=NNC1=CC=CC=C1)Cl
InChIKey LZCJYKSOIZQABU-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is ethyl (2Z)-2-chloro-2-(phenylhydrazinylidene)acetate (CAS: 9000-40-2)?

Ethyl (2Z)-2-chloro-2-(phenylhydrazinylidene)acetate (CAS: 9000-40-2) is an organic compound with th...

Compound Q&A

Is ethyl (2Z)-2-chloro-2-(phenylhydrazinylidene)acetate (CAS: 9000-40-2) safe?

Ethyl (2Z)-2-chloro-2-(phenylhydrazinylidene)acetate (CAS: 9000-40-2) requires careful handling due ...

Compound Q&A

How should ethyl (2Z)-2-chloro-2-(phenylhydrazinylidene)acetate (CAS: 9000-40-2) be stored?

Ethyl (2Z)-2-chloro-2-(phenylhydrazinylidene)acetate (CAS: 9000-40-2) should be stored in a cool, dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...