Compound Q&A

What are the main uses of Sodium [(4-aminophenyl)sulfonyl](2-pyrimidinyl)azanide (CAS: 547-32-0)?

Answer

Sodium [(4-aminophenyl)sulfonyl](2-pyrimidinyl)azanide
Sodium [(4-aminophenyl)sulfonyl](2-pyrimidinyl)azanide is primarily used in pharmaceutical research for the development of drugs targeting specific biological pathways. It serves as an important intermediate in the synthesis of various organic compounds, particularly those involving sulfonyl and azide functionalities. Its applications also extend to chemical synthesis and catalytic processes due to its unique reactivity profile.

About

CAS No 547-32-0
English Name Sodium [(4-aminophenyl)sulfonyl](2-pyrimidinyl)azanide
Molecular Formula C10H9N4NaO2S
Molecular Weight 273.27 g/mol
SMILES O=S(NC1=NC=CC=N1)(C2=CC=C(C=C2)N)=O.[Na]
InChIKey JLDCNMJPBBKAHH-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Sodium [(4-aminophenyl)sulfonyl](2-pyrimidinyl)azanide (CAS: 547-32-0)?

Sodium [(4-aminophenyl)sulfonyl](2-pyrimidinyl)azanide is a chemical compound with the CAS number 54...

Compound Q&A

Is Sodium [(4-aminophenyl)sulfonyl](2-pyrimidinyl)azanide (CAS: 547-32-0) safe?

Sodium [(4-aminophenyl)sulfonyl](2-pyrimidinyl)azanide is generally considered safe when handled pro...

Compound Q&A

How should Sodium [(4-aminophenyl)sulfonyl](2-pyrimidinyl)azanide (CAS: 547-32-0) be stored?

Sodium [(4-aminophenyl)sulfonyl](2-pyrimidinyl)azanide should be stored in a cool, dry, and dark pla...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...