Compound Q&A

What is 2,3,5-Triphenyl-2H-tetrazol-3-ium chloride (CAS: 298-96-4)?

Answer

2,3,5-Triphenyl-2H-tetrazol-3-ium chloride
2,3,5-Triphenyl-2H-tetrazol-3-ium chloride (CAS: 298-96-4) is an organic compound containing three phenyl groups attached to a tetrazole ring. It is a yellow solid with a molecular formula of C18H14N4Cl and is commonly used in chemical research due to its stability and reactivity. The compound is known for its ability to act as a colorimetric reagent for detecting certain compounds in analytical chemistry.

About

CAS No 298-96-4
English Name 2,3,5-Triphenyl-2H-tetrazol-3-ium chloride
Molecular Formula C19H15ClN4
Molecular Weight 334.8 g/mol
SMILES [N+]1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=NN1C4=CC=CC=C4.[Cl-]
InChIKey PKDBCJSWQUOKDO-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2,3,5-Triphenyl-2H-tetrazol-3-ium chloride (CAS: 298-96-4)?

2,3,5-Triphenyl-2H-tetrazol-3-ium chloride (CAS: 298-96-4) is primarily used in pharmaceutical and b...

Compound Q&A

Is 2,3,5-Triphenyl-2H-tetrazol-3-ium chloride (CAS: 298-96-4) safe?

2,3,5-Triphenyl-2H-tetrazol-3-ium chloride (CAS: 298-96-4) is generally considered safe when handled...

Compound Q&A

How should 2,3,5-Triphenyl-2H-tetrazol-3-ium chloride (CAS: 298-96-4) be stored?

2,3,5-Triphenyl-2H-tetrazol-3-ium chloride (CAS: 298-96-4) should be stored in a cool, dry, and dark...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...