Compound Q&A

What is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 71989-14-5)?

Answer

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
This compound is a complex organic molecule with the chemical formula C26H33NO5. It contains a fluorene ring, a butanoic acid group, and multiple functional groups such as amino and hydroxy functionalities. Its structure suggests potential use in pharmaceutical or synthetic chemistry applications due to the presence of functional groups that can participate in various chemical reactions.

About

CAS No 71989-14-5
English Name (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid
Molecular Formula C23H25NO6
Molecular Weight 411.45 g/mol
SMILES CC(C)(C)OC(=O)CC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey FODJWPHPWBKDON-IBGZPJMESA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 71989-14-5)?

This compound is primarily used in pharmaceutical research as a building block for drug development....

Compound Q&A

Is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 71989-14-5) safe?

Safety data for this compound is limited, but as a chemical used in research, it should be handled w...

Compound Q&A

How should (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-[(2-methyl-2-propanyl)oxy]-4-oxobutanoic acid (CAS: 71989-14-5) be stored?

This compound should be stored in a cool, dry, and dark place, ideally at 2-8°C. It should be kept i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...