Compound Q&A

What is Alizarin (CAS: 72-48-0)?

Answer

Alizarin
Alizarin (CAS: 72-48-0) is a synthetic organic compound with the chemical formula C14H8O4. It is a red dye and a derivative of anthracene, commonly used for its vibrant color and chemical properties. Alizarin exhibits pH sensitivity and is known for its role in analytical chemistry and industrial applications, such as textile coloring and staining agents.

About

CAS No 72-48-0
English Name Alizarin
Molecular Formula C14H8O4
Molecular Weight 240.21 g/mol
SMILES Oc1ccc2C(=O)c3ccccc3C(=O)c2c1O
InChIKey RGCKGOZRHPZPFP-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Alizarin (CAS: 72-48-0)?

Alizarin (CAS: 72-48-0) is primarily used as a pH indicator in laboratories, particularly in titrati...

Compound Q&A

Is Alizarin (CAS: 72-48-0) safe?

Alizarin (CAS: 72-48-0) is generally considered safe when used in controlled concentrations, but it ...

Compound Q&A

How should Alizarin (CAS: 72-48-0) be stored?

Alizarin (CAS: 72-48-0) should be stored in a sealed, airtight container in a cool, dry place away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...