Compound Q&A

What are the main uses of 5-Aminoisophthalic acid (CAS: 99-31-0)?

Answer

5-Aminoisophthalic acid
5-Aminoisophthalic acid is primarily used in the pharmaceutical industry for the synthesis of drugs and dyes. It also serves as a key component in the production of certain polymers and is utilized in research for its role in organic chemistry reactions. Additionally, it is applied in the manufacturing of specialty chemicals and materials due to its versatile functional groups.

About

CAS No 99-31-0
English Name 5-Aminoisophthalic acid
Molecular Formula C8H7NO4
Molecular Weight 181.15 g/mol
SMILES C1=C(C=C(C=C1C(=O)O)N)C(=O)O
InChIKey KBZFDRWPMZESDI-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 5-Aminoisophthalic acid (CAS: 99-31-0)?

5-Aminoisophthalic acid is an organic compound with the chemical formula C8H7NO4. It is a derivative...

Compound Q&A

Is 5-Aminoisophthalic acid (CAS: 99-31-0) safe?

5-Aminoisophthalic acid is generally considered safe when handled properly. However, as with many ch...

Compound Q&A

How should 5-Aminoisophthalic acid (CAS: 99-31-0) be stored?

5-Aminoisophthalic acid should be stored in a cool, dry, and dark place to maintain its stability. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...