Compound Q&A

What is Collagen(cattle skin) (CAS: 9064-67-9)?

Answer

Collagen(cattle skin) (9CI)
Collagen(cattle skin) (CAS: 9064-67-9) is a natural protein derived from the connective tissues of cattle. It consists of amino acid sequences forming a fibrous, insoluble structure, primarily composed of glycine, proline, and hydroxyproline. This compound is widely recognized for its role in skin, bone, and cartilage formation. Its molecular weight varies depending on the specific type and source, and it is commonly used in various industries due to its biocompatibility and structural properties.

About

CAS No 9064-67-9
English Name Collagen(cattle skin) (9CI)
Molecular Formula C13H24N4O4
Molecular Weight 300.36 g/mol
SMILES CCC(C)C(C(=O)NC(C)C(=O)NCC(=O)NC(CC1=CC=CC=C1)C(=O)NC(CCCCN)C(=O)NCC(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)N)C(=O)NCC(=O)N2CCCC2C(=O)NC(CCCCN)C(=O)O)NC(=O)CNC(=O)C3CCCN3C(=O)C(CCC(=O)O)NC(=O)CN
InChIKey MAPDXLYMSHJLDR-RTBKNWGFSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Collagen(cattle skin) (CAS: 9064-67-9)?

Collagen(cattle skin) (CAS: 9064-67-9) is utilized in pharmaceuticals for wound healing and skin rep...

Compound Q&A

Is Collagen(cattle skin) (CAS: 9064-67-9) safe?

Collagen(cattle skin) (CAS: 9064-67-9) is generally considered safe when sourced from reputable supp...

Compound Q&A

How should Collagen(cattle skin) (CAS: 9064-67-9) be stored?

Collagen(cattle skin) (CAS: 9064-67-9) should be stored in a cool, dry place (ideally 2-8°C) to main...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...