Compound Q&A

What are the main uses of (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid (CAS: 71989-18-9)?

Answer

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid
This compound is primarily used in pharmaceutical research as a key intermediate in drug synthesis. It also serves in organic chemistry for developing functionalized molecules and is relevant in bioactive compound studies due to its structural complexity and potential reactivity in chemical reactions.

About

CAS No 71989-18-9
English Name (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid
Molecular Formula C24H27NO6
Molecular Weight 425.48 g/mol
SMILES CC(C)(C)OC(=O)CC[C@@H](C(=O)O)NC(=O)OCC1c2ccccc2-c3c1cccc3
InChIKey OTKXCALUHMPIGM-FQEVSTJZSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid (CAS: 71989-18-9)?

This compound is a complex organic molecule with the chemical formula C22H29NO5. It contains a fluor...

Compound Q&A

Is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid (CAS: 71989-18-9) safe?

Safety depends on proper handling. While not inherently toxic in small quantities, it requires prote...

Compound Q&A

How should (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-[(2-methyl-2-propanyl)oxy]-5-oxopentanoic acid (CAS: 71989-18-9) be stored?

Store in a cool (2-8°C), dry, and dark environment to maintain stability. Keep in a sealed, airtight...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...