Compound Q&A

What are the main uses of 3-Methyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 1076-22-8)?

Answer

3-Methyl-3,7-dihydro-1H-purine-2,6-dione
3-Methyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 1076-22-8) is primarily used in pharmaceutical research as a nucleoside analog precursor. It also finds applications in the synthesis of various bioactive compounds and medicinal agents. Additionally, it is utilized in chemical studies to investigate purine-based mechanisms and drug development processes.

About

CAS No 1076-22-8
English Name 3-Methyl-3,7-dihydro-1H-purine-2,6-dione
Molecular Formula C6H6N4O2
Molecular Weight 166.14 g/mol
SMILES Cn1c(=O)[nH]c(=O)c2[nH]cnc12
InChIKey GMSNIKWWOQHZGF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 3-Methyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 1076-22-8)?

3-Methyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 1076-22-8) is a purine derivative with the chemical f...

Compound Q&A

Is 3-Methyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 1076-22-8) safe?

3-Methyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 1076-22-8) is generally considered safe when handled ...

Compound Q&A

How should 3-Methyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 1076-22-8) be stored?

3-Methyl-3,7-dihydro-1H-purine-2,6-dione (CAS: 1076-22-8) should be stored in a cool, dry place, awa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...