Compound Q&A

What is N,N,N-Trimethyl(phenyl)methanaminium chloride (CAS: 56-93-9)?

Answer

N,N,N-Trimethyl(phenyl)methanaminium chloride
N,N,N-Trimethyl(phenyl)methanaminium chloride, with the CAS number 56-93-9, is a quaternary ammonium compound. It has the chemical formula C10H15ClN and is commonly known as trimethylphenylammonium chloride. This compound is typically a white crystalline solid and is soluble in water. It is used as a catalyst in various chemical reactions and is characterized by its cationic nature and ability to interact with anionic species.

About

CAS No 56-93-9
English Name N,N,N-Trimethyl(phenyl)methanaminium chloride
Molecular Formula C10H16ClN
Molecular Weight 185.69 g/mol
SMILES C[N+](C)(C)CC1=CC=CC=C1.[Cl-]
InChIKey KXHPPCXNWTUNSB-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of N,N,N-Trimethyl(phenyl)methanaminium chloride (CAS: 56-93-9)?

N,N,N-Trimethyl(phenyl)methanaminium chloride (CAS: 56-93-9) is primarily used as a catalyst in orga...

Compound Q&A

Is N,N,N-Trimethyl(phenyl)methanaminium chloride (CAS: 56-93-9) safe?

N,N,N-Trimethyl(phenyl)methanaminium chloride (CAS: 56-93-9) is generally considered safe when handl...

Compound Q&A

How should N,N,N-Trimethyl(phenyl)methanaminium chloride (CAS: 56-93-9) be stored?

N,N,N-Trimethyl(phenyl)methanaminium chloride (CAS: 56-93-9) should be stored in a cool, dry place a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...