Compound Q&A

What is 3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium chloride (CAS: 8012-95-1)?

Answer

3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium chloride
3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium chloride is a flavonoid derivative with the chemical formula C15H10O8Cl. It is a yellow solid known for its antioxidant properties and is commonly used in pharmaceutical and research applications. The compound contains multiple hydroxy groups and a chromenium chloride structure, contributing to its biological activity and chemical stability.

About

CAS No 8012-95-1
English Name 3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium chloride
Molecular Formula C15H11ClO7
Molecular Weight 0 g/mol
SMILES c1c(cc(c(c1O)O)O)c2c(cc3c(cc(cc3[o+]2)O)O)O.[Cl-]
InChIKey FFNDMZIBVDSQFI-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium chloride (CAS: 8012-95-1)?

This compound is primarily used in pharmaceuticals as an antioxidant and anti-inflammatory agent. It...

Compound Q&A

Is 3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium chloride (CAS: 8012-95-1) safe?

While 3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium chloride is generally considered safe in...

Compound Q&A

How should 3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium chloride (CAS: 8012-95-1) be stored?

Store 3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)chromenium chloride in a cool, dry place, away from...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...