Compound Q&A

What are the main uses of 2-Fluoro-5-[(4-oxo-3,4-dihydro-1-phthalazinyl)methyl]benzoic acid (CAS: 763114-26-7)?

Answer

2-Fluoro-5-[(4-oxo-3,4-dihydro-1-phthalazinyl)methyl]benzoic acid
2-Fluoro-5-[(4-oxo-3,4-dihydro-1-phthalazinyl)methyl]benzoic acid (CAS: 763114-26-7) is primarily used in pharmaceutical research for the development of drugs targeting neurological disorders. It may also serve as an intermediate in the synthesis of various bioactive compounds. The compound's unique structure makes it valuable in the design of molecules with potential anti-inflammatory or antitumor properties, though its specific applications are still under investigation.

About

English Name 2-Fluoro-5-[(4-oxo-3,4-dihydro-1-phthalazinyl)methyl]benzoic acid
Molecular Formula C16H11FN2O3
Molecular Weight 298.27 g/mol
SMILES C1=CC=C2C(=C1)C(=NNC2=O)CC3=CC(=C(C=C3)F)C(=O)O
InChIKey PAXLJNGPFJEKQX-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 2-Fluoro-5-[(4-oxo-3,4-dihydro-1-phthalazinyl)methyl]benzoic acid (CAS: 763114-26-7)?

2-Fluoro-5-[(4-oxo-3,4-dihydro-1-phthalazinyl)methyl]benzoic acid (CAS: 763114-26-7) is an organic c...

Compound Q&A

Is 2-Fluoro-5-[(4-oxo-3,4-dihydro-1-phthalazinyl)methyl]benzoic acid (CAS: 763114-26-7) safe?

The safety of 2-Fluoro-5-[(4-oxo-3,4-dihydro-1-phthalazinyl)methyl]benzoic acid (CAS: 763114-26-7) h...

Compound Q&A

How should 2-Fluoro-5-[(4-oxo-3,4-dihydro-1-phthalazinyl)methyl]benzoic acid (CAS: 763114-26-7) be stored?

2-Fluoro-5-[(4-oxo-3,4-dihydro-1-phthalazinyl)methyl]benzoic acid (CAS: 763114-26-7) should be store...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...