Compound Q&A

What is 5-Benzoyl-4-hydroxy-2-methoxybenzenesulfonic acid (CAS: 4065-45-6)?

Answer

5-Benzoyl-4-hydroxy-2-methoxybenzenesulfonic acid
5-Benzoyl-4-hydroxy-2-methoxybenzenesulfonic acid (CAS: 4065-45-6) is an aromatic sulfonic acid derivative with a molecular formula of C15H12O5S. It features a benzene ring substituted with a benzoate group, a hydroxyl group, and a methoxy group, making it a versatile intermediate in organic chemistry. The compound is known for its acidic properties and is commonly used in chemical synthesis research.

About

CAS No 4065-45-6
English Name 5-Benzoyl-4-hydroxy-2-methoxybenzenesulfonic acid
Molecular Formula C14H12O6S
Molecular Weight 308.31 g/mol
SMILES COc1cc(c(cc1S(=O)(=O)O)C(=O)c2ccccc2)O
InChIKey CXVGEDCSTKKODG-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 5-Benzoyl-4-hydroxy-2-methoxybenzenesulfonic acid (CAS: 4065-45-6)?

5-Benzoyl-4-hydroxy-2-methoxybenzenesulfonic acid (CAS: 4065-45-6) is primarily used in pharmaceutic...

Compound Q&A

Is 5-Benzoyl-4-hydroxy-2-methoxybenzenesulfonic acid (CAS: 4065-45-6) safe?

5-Benzoyl-4-hydroxy-2-methoxybenzenesulfonic acid (CAS: 4065-45-6) is generally considered safe when...

Compound Q&A

How should 5-Benzoyl-4-hydroxy-2-methoxybenzenesulfonic acid (CAS: 4065-45-6) be stored?

5-Benzoyl-4-hydroxy-2-methoxybenzenesulfonic acid (CAS: 4065-45-6) should be stored in a cool, dry p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...