Compound Q&A

What is 2-(Acryloylamino)-2-methyl-1-propanesulfonic acid (CAS: 15214-89-8)?

Answer

2-(Acryloylamino)-2-methyl-1-propanesulfonic acid
2-(Acryloylamino)-2-methyl-1-propanesulfonic acid (CAS: 15214-89-8) is a synthetic organic compound with the chemical formula C8H15NO6S. It is a white to off-white powder that is soluble in water and has acidic properties due to its sulfonic acid group. This compound is commonly used as a building block in the synthesis of various pharmaceuticals and industrial chemicals.

About

CAS No 15214-89-8
English Name 2-(Acryloylamino)-2-methyl-1-propanesulfonic acid
Molecular Formula C7H13NO4S
Molecular Weight 207.25 g/mol
EINECS 239-268-0
SMILES CC(C)(NC(C=C)=O)CS(=O)(O)=O
InChIKey XHZPRMZZQOIPDS-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2-(Acryloylamino)-2-methyl-1-propanesulfonic acid (CAS: 15214-89-8)?

2-(Acryloylamino)-2-methyl-1-propanesulfonic acid (CAS: 15214-89-8) is widely used in pharmaceutical...

Compound Q&A

Is 2-(Acryloylamino)-2-methyl-1-propanesulfonic acid (CAS: 15214-89-8) safe?

2-(Acryloylamino)-2-methyl-1-propanesulfonic acid (CAS: 15214-89-8) is generally considered safe whe...

Compound Q&A

How should 2-(Acryloylamino)-2-methyl-1-propanesulfonic acid (CAS: 15214-89-8) be stored?

2-(Acryloylamino)-2-methyl-1-propanesulfonic acid (CAS: 15214-89-8) should be stored in a cool, dry,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...