Compound Q&A

What is (2,4,5-Trifluorophenyl)acetic acid (CAS: 209995-38-0)?

Answer

(2,4,5-Trifluorophenyl)acetic acid
(2,4,5-Trifluorophenyl)acetic acid, with the CAS number 209995-38-0, is an organic compound containing a trifluorophenyl group attached to an acetic acid moiety. It is a white to off-white solid with a characteristic acidic odor. The compound is known for its stability and reactivity due to the presence of fluorine atoms, which can influence its chemical properties and biological activity.

About

English Name (2,4,5-Trifluorophenyl)acetic acid
Molecular Formula C8H5F3O2
Molecular Weight 190.12 g/mol
SMILES C1=C(C(=CC(=C1F)F)F)CC(=O)O
InChIKey YSQLGGQUQDTBSL-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (2,4,5-Trifluorophenyl)acetic acid (CAS: 209995-38-0)?

(2,4,5-Trifluorophenyl)acetic acid is primarily used in pharmaceutical research as a building block ...

Compound Q&A

Is (2,4,5-Trifluorophenyl)acetic acid (CAS: 209995-38-0) safe?

While (2,4,5-Trifluorophenyl)acetic acid is generally considered stable under normal conditions, it ...

Compound Q&A

How should (2,4,5-Trifluorophenyl)acetic acid (CAS: 209995-38-0) be stored?

(2,4,5-Trifluorophenyl)acetic acid should be stored in a cool, dry, and well-ventilated area, away f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...