Compound Q&A

What is 2,5-Bis(2-methyl-2-propanyl)-1,4-benzenediol (CAS: 88-58-4)?

Answer

2,5-Bis(2-methyl-2-propanyl)-1,4-benzenediol
2,5-Bis(2-methyl-2-propanyl)-1,4-benzenediol (CAS: 88-58-4) is a dihydroxy compound with a benzene ring substituted at positions 1 and 4 by 2-methyl-2-propanyl groups. It is a white solid with high molecular weight and exhibits strong hydrophilic properties due to its two hydroxyl groups. This compound is known for its stability in various chemical environments and is commonly used in specialized chemical applications.

About

CAS No 88-58-4
English Name 2,5-Bis(2-methyl-2-propanyl)-1,4-benzenediol
Molecular Formula C14H22O2
Molecular Weight 222.33 g/mol
SMILES CC(C)(C)c1cc(O)c(cc1O)C(C)(C)C
InChIKey JZODKRWQWUWGCD-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2,5-Bis(2-methyl-2-propanyl)-1,4-benzenediol (CAS: 88-58-4)?

2,5-Bis(2-methyl-2-propanyl)-1,4-benzenediol (CAS: 88-58-4) is primarily used in pharmaceutical rese...

Compound Q&A

Is 2,5-Bis(2-methyl-2-propanyl)-1,4-benzenediol (CAS: 88-58-4) safe?

2,5-Bis(2-methyl-2-propanyl)-1,4-benzenediol (CAS: 88-58-4) is generally considered safe when handle...

Compound Q&A

How should 2,5-Bis(2-methyl-2-propanyl)-1,4-benzenediol (CAS: 88-58-4) be stored?

2,5-Bis(2-methyl-2-propanyl)-1,4-benzenediol (CAS: 88-58-4) should be stored in a cool, dry, and wel...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...