Compound Q&A

What is Apixaban Impurity 50 (CAS: 545445-44-1)?

Answer

Apixaban Impurity 50
Apixaban Impurity 50 is a chemical compound with the CAS number 545445-44-1. It is an impurity associated with apixaban, an anticoagulant drug used to prevent blood clots. This compound typically has a molecular formula of C19H21N3O4S and is characterized by its structural similarity to the parent drug, making it relevant for quality control and pharmaceutical research.

About

English Name Apixaban Impurity 50
Molecular Formula C20H25N3O3
Molecular Weight 355.44 g/mol
SMILES c1cc(ccc1N2CCCCC2=O)N3CCC=C(C3=O)N4CCOCC4
InChIKey SCVWQFDPLBFZAP-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Apixaban Impurity 50 (CAS: 545445-44-1)?

Apixaban Impurity 50 is primarily used in pharmaceutical research and development to identify and an...

Compound Q&A

Is Apixaban Impurity 50 (CAS: 545445-44-1) safe?

Apixaban Impurity 50 is generally considered safe when handled according to standard laboratory prac...

Compound Q&A

How should Apixaban Impurity 50 (CAS: 545445-44-1) be stored?

Apixaban Impurity 50 should be stored in a cool, dry, and dark place, preferably at 2-8°C. It is imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...