Compound Q&A

What is (2alpha,3beta)-2,3-Dihydroxyurs-12-en-28-oic acid (CAS: 4547-24-4)?

Answer

(2alpha,3beta)-2,3-Dihydroxyurs-12-en-28-oic acid
(2alpha,3beta)-2,3-Dihydroxyurs-12-en-28-oic acid, with the CAS number 4547-24-4, is a naturally occurring triterpenoid compound. It has the chemical formula C30H52O6 and is known for its hydroxyl groups at positions 2 and 3, as well as a carboxylic acid group at position 28. This compound is commonly found in various plants and is characterized by its structural similarity to other ursane-type triterpenoids.

About

CAS No 4547-24-4
English Name (2alpha,3beta)-2,3-Dihydroxyurs-12-en-28-oic acid
Molecular Formula C30H48O4
Molecular Weight 472.71 g/mol
SMILES CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)C)O)O)C)C)C2C1C)C)C(=O)O
InChIKey HFGSQOYIOKBQOW-ZSDYHTTISA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (2alpha,3beta)-2,3-Dihydroxyurs-12-en-28-oic acid (CAS: 4547-24-4)?

(2alpha,3beta)-2,3-Dihydroxyurs-12-en-28-oic acid is primarily used in pharmaceutical research for i...

Compound Q&A

Is (2alpha,3beta)-2,3-Dihydroxyurs-12-en-28-oic acid (CAS: 4547-24-4) safe?

(2alpha,3beta)-2,3-Dihydroxyurs-12-en-28-oic acid is generally considered safe when used in controll...

Compound Q&A

How should (2alpha,3beta)-2,3-Dihydroxyurs-12-en-28-oic acid (CAS: 4547-24-4) be stored?

(2alpha,3beta)-2,3-Dihydroxyurs-12-en-28-oic acid should be stored in a cool, dry, and dark location...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...