Compound Q&A

What is (2R)-2-Acetoxy-3-carboxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 5080-50-2)?

Answer

(2R)-2-Acetoxy-3-carboxy-N,N,N-trimethyl-1-propanaminium chloride
This compound is a quaternary ammonium salt with the molecular formula C9H18ClNO4. It features an acetoxy group at the 2-position, a carboxy group at the 3-position, and three methyl groups attached to the nitrogen atom. Known for its solubility in water and stability under normal conditions, it is commonly used in pharmaceutical and chemical research contexts.

About

CAS No 5080-50-2
English Name (2R)-2-Acetoxy-3-carboxy-N,N,N-trimethyl-1-propanaminium chloride
Molecular Formula C9H18ClNO4
Molecular Weight 239.69 g/mol
SMILES CC(=O)OC(CC(=O)O)C[N+](C)(C)C.[Cl-]
InChIKey JATPLOXBFFRHDN-DDWIOCJRSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of (2R)-2-Acetoxy-3-carboxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 5080-50-2)?

Primarily utilized in pharmaceutical applications, this compound serves as an intermediate in drug s...

Compound Q&A

Is (2R)-2-Acetoxy-3-carboxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 5080-50-2) safe?

When handled properly, this compound is generally considered safe. However, it may cause skin or eye...

Compound Q&A

How should (2R)-2-Acetoxy-3-carboxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 5080-50-2) be stored?

Store in a cool, dry place (2-8°C), protected from light. Use airtight containers to prevent moistur...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...