Compound Q&A

What is Bis(8-quinolinolato)copper(II) (CAS: 10380-28-6)?

Answer

Bis(8-quinolinolato)copper(II)
Bis(8-quinolinolato)copper(II) is a copper complex with the chemical formula Cu(C14H9NO2)2. It is a bright red crystalline solid commonly used in various chemical applications. The compound is known for its stability and solubility in certain solvents, and it is widely recognized in the chemical industry for its unique properties.

About

CAS No 10380-28-6
English Name Bis(8-quinolinolato)copper(II)
Molecular Formula C18H14CuN2O2
Molecular Weight 353.9 g/mol
SMILES C1=CC2=C(C(=C1)O)N=CC=C2.C1=CC2=C(C(=C1)O)N=CC=C2.[Cu]
InChIKey IURRXCRWRKQLGC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Bis(8-quinolinolato)copper(II) (CAS: 10380-28-6)?

Bis(8-quinolinolato)copper(II) is primarily used in pharmaceutical research, as a catalyst in organi...

Compound Q&A

Is Bis(8-quinolinolato)copper(II) (CAS: 10380-28-6) safe?

Bis(8-quinolinolato)copper(II) is generally considered safe when handled properly. However, it shoul...

Compound Q&A

How should Bis(8-quinolinolato)copper(II) (CAS: 10380-28-6) be stored?

Bis(8-quinolinolato)copper(II) should be stored in a cool, dry, and dark place to maintain its stabi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...