Compound Q&A

What are the main uses of Tributyl 2-acetoxy-1,2,3-propanetricarboxylate (CAS: 77-90-7)?

Answer

Tributyl 2-acetoxy-1,2,3-propanetricarboxylate
Tributyl 2-acetoxy-1,2,3-propanetricarboxylate is primarily used in pharmaceutical and industrial applications. It serves as a key intermediate in the synthesis of various organic compounds, including pharmaceuticals and polymers. Additionally, it is employed in research settings for developing new materials and chemical processes. Its versatility makes it valuable in multiple sectors requiring chemical synthesis.

About

CAS No 77-90-7
English Name Tributyl 2-acetoxy-1,2,3-propanetricarboxylate
Molecular Formula C20H34O8
Molecular Weight 402.48 g/mol
SMILES CCCCOC(=O)CC(CC(=O)OCCCC)(C(=O)OCCCC)OC(=O)C
InChIKey QZCLKYGREBVARF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Tributyl 2-acetoxy-1,2,3-propanetricarboxylate (CAS: 77-90-7)?

Tributyl 2-acetoxy-1,2,3-propanetricarboxylate is an organic compound with the CAS number 77-90-7. I...

Compound Q&A

Is Tributyl 2-acetoxy-1,2,3-propanetricarboxylate (CAS: 77-90-7) safe?

Tributyl 2-acetoxy-1,2,3-propanetricarboxylate is generally considered safe when handled properly. H...

Compound Q&A

How should Tributyl 2-acetoxy-1,2,3-propanetricarboxylate (CAS: 77-90-7) be stored?

Tributyl 2-acetoxy-1,2,3-propanetricarboxylate should be stored in a cool, dry, and well-ventilated ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...