Compound Q&A

What is tetrabutylazanium hydrogen sulfate (CAS: 32503-27-8)?

Answer

tetrabutylazanium hydrogen sulfate
Tetrabutylazanium hydrogen sulfate is a quaternary ammonium salt with the chemical formula C16H36N2OS. It is a white crystalline solid that is soluble in water and commonly used as a surfactant and catalyst. The compound exhibits good thermal stability and is often employed in various chemical processes due to its unique ionic properties.

About

CAS No 32503-27-8
English Name tetrabutylazanium hydrogen sulfate
Molecular Formula C16H37NO4S
Molecular Weight 339.5 g/mol
SMILES CCCC[N+](CCCC)(CCCC)CCCC.OS(=O)(=O)[O-]
InChIKey APALITYSHSEBAM-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of tetrabutylazanium hydrogen sulfate (CAS: 32503-27-8)?

Tetrabutylazanium hydrogen sulfate is primarily used in pharmaceuticals as a stabilizer and in indus...

Compound Q&A

Is tetrabutylazanium hydrogen sulfate (CAS: 32503-27-8) safe?

Tetrabutylazanium hydrogen sulfate is generally considered safe when handled properly. However, it s...

Compound Q&A

How should tetrabutylazanium hydrogen sulfate (CAS: 32503-27-8) be stored?

Tetrabutylazanium hydrogen sulfate should be stored in a cool, dry place away from direct light. It ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...