Compound Q&A

What are the main uses of 5-Bromo-2-chlorobenzoic acid (CAS: 21739-92-4)?

Answer

5-Bromo-2-chlorobenzoic acid
5-Bromo-2-chlorobenzoic acid is primarily used in pharmaceutical research for the development of drugs targeting metabolic disorders and inflammation. It also finds applications in organic synthesis, dye production, and as an intermediate in the manufacturing of various chemicals. Its unique structure makes it valuable in research and industrial processes.

About

CAS No 21739-92-4
English Name 5-Bromo-2-chlorobenzoic acid
Molecular Formula C7H4BrClO2
Molecular Weight 235.46 g/mol
SMILES C1=CC(=C(C=C1Br)C(=O)O)Cl
InChIKey FGERXQWKKIVFQG-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 5-Bromo-2-chlorobenzoic acid (CAS: 21739-92-4)?

5-Bromo-2-chlorobenzoic acid is an organic compound with the chemical formula C7H5BrClO2. It is a su...

Compound Q&A

Is 5-Bromo-2-chlorobenzoic acid (CAS: 21739-92-4) safe?

5-Bromo-2-chlorobenzoic acid is considered hazardous due to its potential to cause skin and eye irri...

Compound Q&A

How should 5-Bromo-2-chlorobenzoic acid (CAS: 21739-92-4) be stored?

5-Bromo-2-chlorobenzoic acid should be stored in a cool, dry, and dark place, preferably at temperat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...